About 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione
5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione (PubChem CID 131731366) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione.
Molecular Properties
| Compound Name | 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione |
| PubChem CID | 131731366 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione |
| SMILES | CCCCC1CC2C=CC1C2.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C11H18.C4H2O3/c1-2-3-4-10-7-9-5-6-11(10)8-9;5-3-1-2-4(6)7-3/h5-6,9-11H,2-4,7-8H2,1H3;1-2H |
| InChIKey | SCKUESNWIBJVJV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
The IUPAC name of 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione (CID 131731366) is 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione.
What is the SMILES notation for 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
The canonical SMILES for 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione is CCCCC1CC2C=CC1C2.O=C1C=CC(=O)O1.
What is the InChIKey of 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
The InChIKey is SCKUESNWIBJVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18.C4H2O3/c1-2-3-4-10-7-9-5-6-11(10)8-9;5-3-1-2-4(6)7-3/h5-6,9-11H,2-4,7-8H2,1H3;1-2H.
What are the key properties of 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione has a molecular weight of 248.32 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione is sourced from PubChem (CID 131731366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).