About 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione
1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione (PubChem CID 131731368) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione.
Molecular Properties
| Compound Name | 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione |
| PubChem CID | 131731368 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione |
| SMILES | CCC12CCC(C=C1c1ccccc1)C2.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C15H18.C4H2O3/c1-2-15-9-8-12(11-15)10-14(15)13-6-4-3-5-7-13;5-3-1-2-4(6)7-3/h3-7,10,12H,2,8-9,11H2,1H3;1-2H |
| InChIKey | NRWHOVQOJZXCLA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
The IUPAC name of 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione (CID 131731368) is 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione.
What is the SMILES notation for 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
The canonical SMILES for 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione is CCC12CCC(C=C1c1ccccc1)C2.O=C1C=CC(=O)O1.
What is the InChIKey of 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
The InChIKey is NRWHOVQOJZXCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18.C4H2O3/c1-2-15-9-8-12(11-15)10-14(15)13-6-4-3-5-7-13;5-3-1-2-4(6)7-3/h3-7,10,12H,2,8-9,11H2,1H3;1-2H.
What are the key properties of 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione?
1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione has a molecular weight of 296.37 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-phenylbicyclo[2.2.1]hept-2-ene;furan-2,5-dione is sourced from PubChem (CID 131731368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).