About (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide
(2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide (PubChem CID 131731407) has the molecular formula C7H6F6N2O6S2
and a molecular weight of 392.26 g/mol. Its IUPAC name is (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide |
| PubChem CID | 131731407 |
| Molecular Formula | C7H6F6N2O6S2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@@H](C(=O)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)N1 |
| InChI | InChI=1S/C7H6F6N2O6S2/c8-6(9,10)22(18,19)15(23(20,21)7(11,12)13)5(17)3-1-2-4(16)14-3/h3H,1-2H2,(H,14,16)/t3-/m0/s1 |
| InChIKey | JCOICYBDGBTMRC-VKHMYHEASA-N |
| XLogP | -0.21 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide (CID 131731407) is (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide is O=C1CC[C@@H](C(=O)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)N1.
What is the InChIKey of (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide?
The InChIKey is JCOICYBDGBTMRC-VKHMYHEASA-N. The full InChI is InChI=1S/C7H6F6N2O6S2/c8-6(9,10)22(18,19)15(23(20,21)7(11,12)13)5(17)3-1-2-4(16)14-3/h3H,1-2H2,(H,14,16)/t3-/m0/s1.
What are the key properties of (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide?
(2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide has a molecular weight of 392.26 g/mol, XLogP of -0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-oxo-N,N-bis(trifluoromethylsulfonyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 131731407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).