C19H19N3O5 — CID 131731576
methyl (2S)-3-methyl-2-[5-(6-nitro-3-pyridinyl)-3-oxo-1H-isoindol-2-yl]butanoate (PubChem CID 131731576) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[5-(6-nitro-3-pyridinyl)-3-oxo-1H-isoindol-2-yl]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[5-(6-nitro-3-pyridinyl)-3-oxo-1H-isoindol-2-yl]butanoate |
|---|---|
| PubChem CID | 131731576 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methyl (2S)-3-methyl-2-[5-(6-nitro-3-pyridinyl)-3-oxo-1H-isoindol-2-yl]butanoate |
| SMILES | COC(=O)[C@H](C(C)C)N1Cc2ccc(-c3ccc([N+](=O)[O-])nc3)cc2C1=O |
| InChI | InChI=1S/C19H19N3O5/c1-11(2)17(19(24)27-3)21-10-14-5-4-12(8-15(14)18(21)23)13-6-7-16(20-9-13)22(25)26/h4-9,11,17H,10H2,1-3H3/t17-/m0/s1 |
| InChIKey | WZNGCDVWTRQJKX-KRWDZBQOSA-N |
| XLogP | 2.81 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|