About N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate
N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate (PubChem CID 131731663) has the molecular formula C12H20NO3-
and a molecular weight of 226.30 g/mol. Its IUPAC name is N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate.
Molecular Properties
| Compound Name | N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate |
| PubChem CID | 131731663 |
| Molecular Formula | C12H20NO3- |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate |
| SMILES | CC(C)(C)N(C(=O)[O-])[C@H]1CCCC[C@H]1C=O |
| InChI | InChI=1S/C12H21NO3/c1-12(2,3)13(11(15)16)10-7-5-4-6-9(10)8-14/h8-10H,4-7H2,1-3H3,(H,15,16)/p-1/t9-,10-/m0/s1 |
| InChIKey | NELLMPUYVBOJGE-UWVGGRQHSA-M |
| XLogP | 1.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate?
The IUPAC name of N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate (CID 131731663) is N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate.
What is the SMILES notation for N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate?
The canonical SMILES for N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate is CC(C)(C)N(C(=O)[O-])[C@H]1CCCC[C@H]1C=O.
What is the InChIKey of N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate?
The InChIKey is NELLMPUYVBOJGE-UWVGGRQHSA-M. The full InChI is InChI=1S/C12H21NO3/c1-12(2,3)13(11(15)16)10-7-5-4-6-9(10)8-14/h8-10H,4-7H2,1-3H3,(H,15,16)/p-1/t9-,10-/m0/s1.
What are the key properties of N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate?
N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate has a molecular weight of 226.30 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[(1S,2R)-2-formylcyclohexyl]carbamate is sourced from PubChem (CID 131731663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).