C54H58Cl2N12O10 — CID 131731755
bis(4-[4-[5-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]-3-chlorobenzoic acid);(E)-but-2-enedioic acid (PubChem CID 131731755) has the molecular formula C54H58Cl2N12O10 and a molecular weight of 1106.04 g/mol. Its IUPAC name is bis(4-[4-[5-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]-3-chlorobenzoic acid);(E)-but-2-enedioic acid.
| Compound Name | bis(4-[4-[5-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]-3-chlorobenzoic acid);(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 131731755 |
| Molecular Formula | C54H58Cl2N12O10 |
| Molecular Weight | 1106.04 g/mol |
| Exact Mass | 1104.38 |
| IUPAC Name | bis(4-[4-[5-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]pyrimidin-2-yl]piperazin-1-yl]-3-chlorobenzoic acid);(E)-but-2-enedioic acid |
| SMILES | CN(Cc1cccc(-c2cnc(N3CCN(c4ccc(C(=O)O)cc4Cl)CC3)nc2)c1)C(=O)CN.CN(Cc1cccc(-c2cnc(N3CCN(c4ccc(C(=O)O)cc4Cl)CC3)nc2)c1)C(=O)CN.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C25H27ClN6O3.C4H4O4/c2*1-30(23(33)13-27)16-17-3-2-4-18(11-17)20-14-28-25(29-15-20)32-9-7-31(8-10-32)22-6-5-19(24(34)35)12-21(22)26;5-3(6)1-2-4(7)8/h2*2-6,11-12,14-15H,7-10,13,16,27H2,1H3,(H,34,35);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | OGKKHRRAFZZGFX-WXXKFALUSA-N |
| XLogP | 5.19 |
| TPSA | 306.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.04 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|