About 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one
2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one (PubChem CID 131731835) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one |
| PubChem CID | 131731835 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one |
| SMILES | CCC1CC(=O)N(C)C(N)=N1 |
| InChI | InChI=1S/C7H13N3O/c1-3-5-4-6(11)10(2)7(8)9-5/h5H,3-4H2,1-2H3,(H2,8,9) |
| InChIKey | KASQRCSCGUMFTF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one?
The IUPAC name of 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one (CID 131731835) is 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one.
What is the SMILES notation for 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one?
The canonical SMILES for 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one is CCC1CC(=O)N(C)C(N)=N1.
What is the InChIKey of 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one?
The InChIKey is KASQRCSCGUMFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-3-5-4-6(11)10(2)7(8)9-5/h5H,3-4H2,1-2H3,(H2,8,9).
What are the key properties of 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one?
2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one has a molecular weight of 155.20 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-ethyl-1-methyl-4,5-dihydropyrimidin-6-one is sourced from PubChem (CID 131731835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).