3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid

C7H12F3NO4 — CID 131732215

IUPAC3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid
SMILESCC(C)(CN)C(=O)O.O=C(O)C(F)(F)F
InChIInChI=1S/C5H11NO2.C2HF3O2/c1-5(2,3-6)4(7)8;3-2(4,5)1(6)7/h3,6H2,1-2H3,(H,7,8);(H,6,7)
InChIKeyZVNJUYNIVDGWHP-UHFFFAOYSA-N
MW231.17 g/mol
LogP0.69
Rot. Bonds2

About 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid

3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 131732215) has the molecular formula C7H12F3NO4 and a molecular weight of 231.17 g/mol. Its IUPAC name is 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid
PubChem CID131732215
Molecular FormulaC7H12F3NO4
Molecular Weight231.17 g/mol
Exact Mass231.07
IUPAC Name3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid
SMILESCC(C)(CN)C(=O)O.O=C(O)C(F)(F)F
InChIInChI=1S/C5H11NO2.C2HF3O2/c1-5(2,3-6)4(7)8;3-2(4,5)1(6)7/h3,6H2,1-2H3,(H,7,8);(H,6,7)
InChIKeyZVNJUYNIVDGWHP-UHFFFAOYSA-N
XLogP0.69
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.17
LogP ≤ 50.69
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid (CID 131732215) is 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid is CC(C)(CN)C(=O)O.O=C(O)C(F)(F)F.
What is the InChIKey of 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid?
The InChIKey is ZVNJUYNIVDGWHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C2HF3O2/c1-5(2,3-6)4(7)8;3-2(4,5)1(6)7/h3,6H2,1-2H3,(H,7,8);(H,6,7).
What are the key properties of 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid?
3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid has a molecular weight of 231.17 g/mol, XLogP of 0.69, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,2-dimethylpropanoic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 131732215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).