C20H31ClN4O3Si — CID 131732376
methyl N-[(3R,4R)-1-(3-amino-2-chloro-5-cyanophenyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate (PubChem CID 131732376) has the molecular formula C20H31ClN4O3Si and a molecular weight of 439.03 g/mol. Its IUPAC name is methyl N-[(3R,4R)-1-(3-amino-2-chloro-5-cyanophenyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate.
| Compound Name | methyl N-[(3R,4R)-1-(3-amino-2-chloro-5-cyanophenyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 131732376 |
| Molecular Formula | C20H31ClN4O3Si |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl N-[(3R,4R)-1-(3-amino-2-chloro-5-cyanophenyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidin-4-yl]carbamate |
| SMILES | COC(=O)N[C@@H]1CCN(c2cc(C#N)cc(N)c2Cl)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31ClN4O3Si/c1-20(2,3)29(5,6)28-17-12-25(8-7-15(17)24-19(26)27-4)16-10-13(11-22)9-14(23)18(16)21/h9-10,15,17H,7-8,12,23H2,1-6H3,(H,24,26)/t15-,17-/m1/s1 |
| InChIKey | JHGYKIQUQRNFHF-NVXWUHKLSA-N |
| XLogP | 4.12 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|