C7H13FN2O2 — CID 131732391
methyl N-[(3R,4S)-3-fluoropiperidin-4-yl]carbamate (PubChem CID 131732391) has the molecular formula C7H13FN2O2 and a molecular weight of 176.19 g/mol. Its IUPAC name is methyl N-[(3R,4S)-3-fluoropiperidin-4-yl]carbamate.
| Compound Name | methyl N-[(3R,4S)-3-fluoropiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 131732391 |
| Molecular Formula | C7H13FN2O2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | methyl N-[(3R,4S)-3-fluoropiperidin-4-yl]carbamate |
| SMILES | COC(=O)N[C@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C7H13FN2O2/c1-12-7(11)10-6-2-3-9-4-5(6)8/h5-6,9H,2-4H2,1H3,(H,10,11)/t5-,6+/m1/s1 |
| InChIKey | MXMIVQNUROQHFI-RITPCOANSA-N |
| XLogP | 0.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |