C23H26BrN5O3SSi — CID 131732644
ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 131732644) has the molecular formula C23H26BrN5O3SSi and a molecular weight of 560.55 g/mol. Its IUPAC name is ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 131732644 |
| Molecular Formula | C23H26BrN5O3SSi |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | ethyl 4-[3-(3-bromo-1,2,4-thiadiazol-5-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cn(COCC[Si](C)(C)C)c2ncnc(-c3cccc(-c4nc(Br)ns4)c3)c12 |
| InChI | InChI=1S/C23H26BrN5O3SSi/c1-5-32-22(30)17-12-29(14-31-9-10-34(2,3)4)20-18(17)19(25-13-26-20)15-7-6-8-16(11-15)21-27-23(24)28-33-21/h6-8,11-13H,5,9-10,14H2,1-4H3 |
| InChIKey | KEIRCMHRVKVZND-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|