C15H14ClFNO4- — CID 131733094
2-(2-chloro-4-cyano-3-fluorophenyl)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoate (PubChem CID 131733094) has the molecular formula C15H14ClFNO4- and a molecular weight of 326.73 g/mol. Its IUPAC name is 2-(2-chloro-4-cyano-3-fluorophenyl)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoate.
| Compound Name | 2-(2-chloro-4-cyano-3-fluorophenyl)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoate |
|---|---|
| PubChem CID | 131733094 |
| Molecular Formula | C15H14ClFNO4- |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-(2-chloro-4-cyano-3-fluorophenyl)-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C(=O)[O-])c1ccc(C#N)c(F)c1Cl |
| InChI | InChI=1S/C15H15ClFNO4/c1-14(2,3)22-13(21)15(4,12(19)20)9-6-5-8(7-18)11(17)10(9)16/h5-6H,1-4H3,(H,19,20)/p-1 |
| InChIKey | JDQXAOIZMINLND-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 90.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|