C42H62O6Si2 — CID 131733244
(2S,4R,6S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-6-[(2S)-2-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-4-ol (PubChem CID 131733244) has the molecular formula C42H62O6Si2 and a molecular weight of 719.12 g/mol. Its IUPAC name is (2S,4R,6S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-6-[(2S)-2-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-4-ol.
| Compound Name | (2S,4R,6S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-6-[(2S)-2-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-4-ol |
|---|---|
| PubChem CID | 131733244 |
| Molecular Formula | C42H62O6Si2 |
| Molecular Weight | 719.12 g/mol |
| Exact Mass | 718.41 |
| IUPAC Name | (2S,4R,6S)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]butyl]-6-[(2S)-2-hydroxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-4-ol |
| SMILES | C=C(C[C@H](O)C[C@H]1C[C@@H](O)C[C@@H](C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCc2ccc(OC)cc2)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C42H62O6Si2/c1-32(31-49(6,7)8)25-34(43)26-38-27-35(44)28-39(48-38)29-37(46-30-33-19-21-36(45-5)22-20-33)23-24-47-50(42(2,3)4,40-15-11-9-12-16-40)41-17-13-10-14-18-41/h9-22,34-35,37-39,43-44H,1,23-31H2,2-8H3/t34-,35+,37-,38-,39-/m0/s1 |
| InChIKey | YDOJWZIVZRZOKX-XNVAUQMESA-N |
| XLogP | 7.88 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.12 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|