C23H30O3 — CID 131733270
4-[5-(2,6-diethyl-4-methylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]butanal (PubChem CID 131733270) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 4-[5-(2,6-diethyl-4-methylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]butanal.
| Compound Name | 4-[5-(2,6-diethyl-4-methylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]butanal |
|---|---|
| PubChem CID | 131733270 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-[5-(2,6-diethyl-4-methylphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]butanal |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)C2CC(CCCC=O)CC2C1=O |
| InChI | InChI=1S/C23H30O3/c1-4-16-10-14(3)11-17(5-2)20(16)21-22(25)18-12-15(8-6-7-9-24)13-19(18)23(21)26/h9-11,15,18-19,21H,4-8,12-13H2,1-3H3 |
| InChIKey | QDYNVVUEIOICSN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|