About 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate
1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate (PubChem CID 131733403) has the molecular formula C21H31FN2O2
and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl N-[2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate |
| PubChem CID | 131733403 |
| Molecular Formula | C21H31FN2O2 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl N-[2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)CC1=CC(=C(C=C1)F)C(C)(C)NC(=O)OC2CN3CCC2CC3 |
| InChI | InChI=1S/C21H31FN2O2/c1-14(2)11-15-5-6-18(22)17(12-15)21(3,4)23-20(25)26-19-13-24-9-7-16(19)8-10-24/h5-6,12,14,16,19H,7-11,13H2,1-4H3,(H,23,25) |
| InChIKey | YQNHCCILOTXJJJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 488 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate?
The IUPAC name of 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate (CID 131733403) is 1-azabicyclo[2.2.2]octan-3-yl N-[2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl]carbamate.
What is the SMILES notation for 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate?
The canonical SMILES for 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate is CC(C)CC1=CC(=C(C=C1)F)C(C)(C)NC(=O)OC2CN3CCC2CC3.
What is the InChIKey of 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate?
The InChIKey is YQNHCCILOTXJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31FN2O2/c1-14(2)11-15-5-6-18(22)17(12-15)21(3,4)23-20(25)26-19-13-24-9-7-16(19)8-10-24/h5-6,12,14,16,19H,7-11,13H2,1-4H3,(H,23,25).
What are the key properties of 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate?
1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate has a molecular weight of 362.50 g/mol, XLogP of 4.30, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Azabicyclo[2.2.2]oct-3-yl {2-[2-fluoro-5-(2-methylpropyl)phenyl]propan-2-yl}carbamate is sourced from PubChem (CID 131733403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).