C20H31NO4S — CID 131733435
tert-butyl N-[(3R)-3-hydroxy-3-[3-(thian-3-ylmethoxy)phenyl]propyl]carbamate (PubChem CID 131733435) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-hydroxy-3-[3-(thian-3-ylmethoxy)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-hydroxy-3-[3-(thian-3-ylmethoxy)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 131733435 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | tert-butyl N-[(3R)-3-hydroxy-3-[3-(thian-3-ylmethoxy)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](O)c1cccc(OCC2CCCSC2)c1 |
| InChI | InChI=1S/C20H31NO4S/c1-20(2,3)25-19(23)21-10-9-18(22)16-7-4-8-17(12-16)24-13-15-6-5-11-26-14-15/h4,7-8,12,15,18,22H,5-6,9-11,13-14H2,1-3H3,(H,21,23)/t15?,18-/m1/s1 |
| InChIKey | DSWAZDDDYLKERE-KPMSDPLLSA-N |
| XLogP | 4.16 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |