methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate

C8H13NO3 — CID 131733580

IUPACmethyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate
SMILESCOC(=O)C1CC(=NO)C1(C)C
InChIInChI=1S/C8H13NO3/c1-8(2)5(7(10)12-3)4-6(8)9-11/h5,11H,4H2,1-3H3
InChIKeyKFUSTBHUVWNFHM-UHFFFAOYSA-N
MW171.20 g/mol
LogP1.04
Rot. Bonds1

About methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate

methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate (PubChem CID 131733580) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate
PubChem CID131733580
Molecular FormulaC8H13NO3
Molecular Weight171.20 g/mol
Exact Mass171.09
IUPAC Namemethyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate
SMILESCOC(=O)C1CC(=NO)C1(C)C
InChIInChI=1S/C8H13NO3/c1-8(2)5(7(10)12-3)4-6(8)9-11/h5,11H,4H2,1-3H3
InChIKeyKFUSTBHUVWNFHM-UHFFFAOYSA-N
XLogP1.04
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.20
LogP ≤ 51.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate?
The IUPAC name of methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate (CID 131733580) is methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate.
What is the SMILES notation for methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate?
The canonical SMILES for methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate is COC(=O)C1CC(=NO)C1(C)C.
What is the InChIKey of methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate?
The InChIKey is KFUSTBHUVWNFHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-8(2)5(7(10)12-3)4-6(8)9-11/h5,11H,4H2,1-3H3.
What are the key properties of methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate?
methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate has a molecular weight of 171.20 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxyimino-2,2-dimethylcyclobutane-1-carboxylate is sourced from PubChem (CID 131733580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).