C25H24F6O4S2 — CID 131733662
bis(3,5-dimethylphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate (PubChem CID 131733662) has the molecular formula C25H24F6O4S2 and a molecular weight of 566.59 g/mol. Its IUPAC name is bis(3,5-dimethylphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate.
| Compound Name | bis(3,5-dimethylphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 131733662 |
| Molecular Formula | C25H24F6O4S2 |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | bis(3,5-dimethylphenyl)-(4-fluorophenyl)sulfanium;1,1,3,3,3-pentafluoro-2-hydroxypropane-1-sulfonate |
| SMILES | Cc1cc(C)cc([S+](c2ccc(F)cc2)c2cc(C)cc(C)c2)c1.O=S(=O)([O-])C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C22H22FS.C3H3F5O4S/c1-15-9-16(2)12-21(11-15)24(20-7-5-19(23)6-8-20)22-13-17(3)10-18(4)14-22;4-2(5,6)1(9)3(7,8)13(10,11)12/h5-14H,1-4H3;1,9H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | OOFUHRFFQGWSNL-UHFFFAOYSA-M |
| XLogP | 6.20 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|