C42H68N12O4 — CID 131733679
(Z)-but-2-enedioic acid;bis(5-butyl-3-(6-pyrrolidin-1-ylhexyl)-2H-pyrazolo[4,3-d]pyrimidin-7-amine) (PubChem CID 131733679) has the molecular formula C42H68N12O4 and a molecular weight of 805.09 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(5-butyl-3-(6-pyrrolidin-1-ylhexyl)-2H-pyrazolo[4,3-d]pyrimidin-7-amine).
| Compound Name | (Z)-but-2-enedioic acid;bis(5-butyl-3-(6-pyrrolidin-1-ylhexyl)-2H-pyrazolo[4,3-d]pyrimidin-7-amine) |
|---|---|
| PubChem CID | 131733679 |
| Molecular Formula | C42H68N12O4 |
| Molecular Weight | 805.09 g/mol |
| Exact Mass | 804.55 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(5-butyl-3-(6-pyrrolidin-1-ylhexyl)-2H-pyrazolo[4,3-d]pyrimidin-7-amine) |
| SMILES | CCCCc1nc(N)c2n[nH]c(CCCCCCN3CCCC3)c2n1.CCCCc1nc(N)c2n[nH]c(CCCCCCN3CCCC3)c2n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/2C19H32N6.C4H4O4/c2*1-2-3-11-16-21-17-15(23-24-18(17)19(20)22-16)10-6-4-5-7-12-25-13-8-9-14-25;5-3(6)1-2-4(7)8/h2*2-14H2,1H3,(H,23,24)(H2,20,21,22);1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | YUJKESJLQOFTNA-KSBRXOFISA-N |
| XLogP | 6.66 |
| TPSA | 242.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.09 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|