C22H40BN3O6 — CID 131734235
(1S,2S,4S)-1-acetamido-N-tert-butyl-4-(nitromethyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide (PubChem CID 131734235) has the molecular formula C22H40BN3O6 and a molecular weight of 453.39 g/mol. Its IUPAC name is (1S,2S,4S)-1-acetamido-N-tert-butyl-4-(nitromethyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide.
| Compound Name | (1S,2S,4S)-1-acetamido-N-tert-butyl-4-(nitromethyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 131734235 |
| Molecular Formula | C22H40BN3O6 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | (1S,2S,4S)-1-acetamido-N-tert-butyl-4-(nitromethyl)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentane-1-carboxamide |
| SMILES | CC(=O)N[C@@]1(C(=O)NC(C)(C)C)C[C@@H](C[N+](=O)[O-])C[C@@H]1CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H40BN3O6/c1-15(27)24-22(18(28)25-19(2,3)4)13-16(14-26(29)30)12-17(22)10-9-11-23-31-20(5,6)21(7,8)32-23/h16-17H,9-14H2,1-8H3,(H,24,27)(H,25,28)/t16-,17-,22-/m0/s1 |
| InChIKey | VCZFXHJGPVFAGA-HOIFWPIMSA-N |
| XLogP | 2.95 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|