C22H27NO4Si — CID 131734310
tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-5-(2-trimethylsilylethynyl)-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate (PubChem CID 131734310) has the molecular formula C22H27NO4Si and a molecular weight of 397.55 g/mol. Its IUPAC name is tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-5-(2-trimethylsilylethynyl)-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-5-(2-trimethylsilylethynyl)-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 131734310 |
| Molecular Formula | C22H27NO4Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl (3Z)-3-(hydroxymethylidene)-2-oxo-5-(2-trimethylsilylethynyl)-4,8b-dihydro-3aH-indeno[1,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)/C(=C\O)C2Cc3c(C#C[Si](C)(C)C)cccc3C21 |
| InChI | InChI=1S/C22H27NO4Si/c1-22(2,3)27-21(26)23-19-15-9-7-8-14(10-11-28(4,5)6)16(15)12-17(19)18(13-24)20(23)25/h7-9,13,17,19,24H,12H2,1-6H3/b18-13- |
| InChIKey | SRDWHIHNGHUZOJ-AQTBWJFISA-N |
| XLogP | 4.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|