C22H34B2N4O4 — CID 131734669
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 131734669) has the molecular formula C22H34B2N4O4 and a molecular weight of 440.16 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 131734669 |
| Molecular Formula | C22H34B2N4O4 |
| Molecular Weight | 440.16 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2ccc(N)nc2)OC1(C)C.CC1(C)OB(c2ccc(N)nc2)OC1(C)C |
| InChI | InChI=1S/2C11H17BN2O2/c2*1-10(2)11(3,4)16-12(15-10)8-5-6-9(13)14-7-8/h2*5-7H,1-4H3,(H2,13,14) |
| InChIKey | IGZCYJHEVCDQQS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|