C24H35FN4O4Si — CID 131734776
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(dimethoxymethyl)-N-(5-fluoro-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 131734776) has the molecular formula C24H35FN4O4Si and a molecular weight of 490.65 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(dimethoxymethyl)-N-(5-fluoro-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(dimethoxymethyl)-N-(5-fluoro-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 131734776 |
| Molecular Formula | C24H35FN4O4Si |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-(dimethoxymethyl)-N-(5-fluoro-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COC(OC)c1nc2c(cc1CO[Si](C)(C)C(C)(C)C)CCCN2C(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C24H35FN4O4Si/c1-24(2,3)34(6,7)33-15-17-13-16-9-8-12-29(21(16)28-20(17)22(31-4)32-5)23(30)27-19-11-10-18(25)14-26-19/h10-11,13-14,22H,8-9,12,15H2,1-7H3,(H,26,27,30) |
| InChIKey | IEFOPKOTVULRRC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|