C14H17ClN4O — CID 131734934
3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-amino-4-chlorobenzonitrile (PubChem CID 131734934) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-amino-4-chlorobenzonitrile.
| Compound Name | 3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-amino-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 131734934 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-5-amino-4-chlorobenzonitrile |
| SMILES | N#Cc1cc(N)c(Cl)c(N2CCN3C[C@H](O)C[C@H]3C2)c1 |
| InChI | InChI=1S/C14H17ClN4O/c15-14-12(17)3-9(6-16)4-13(14)19-2-1-18-8-11(20)5-10(18)7-19/h3-4,10-11,20H,1-2,5,7-8,17H2/t10-,11+/m0/s1 |
| InChIKey | SZSJILXPOCAFJK-WDEREUQCSA-N |
| XLogP | 1.05 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|