C24H38O5 — CID 131735722
methyl (3R,3aR,7aR)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-6-oxo-5-(3-oxooct-7-enyl)-1,2,3,4,7,7a-hexahydroindene-5-carboxylate (PubChem CID 131735722) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is methyl (3R,3aR,7aR)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-6-oxo-5-(3-oxooct-7-enyl)-1,2,3,4,7,7a-hexahydroindene-5-carboxylate.
| Compound Name | methyl (3R,3aR,7aR)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-6-oxo-5-(3-oxooct-7-enyl)-1,2,3,4,7,7a-hexahydroindene-5-carboxylate |
|---|---|
| PubChem CID | 131735722 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | methyl (3R,3aR,7aR)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-6-oxo-5-(3-oxooct-7-enyl)-1,2,3,4,7,7a-hexahydroindene-5-carboxylate |
| SMILES | C=CCCCC(=O)CCC1(C(=O)OC)C[C@]2(C)[C@H](CC[C@H]2OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C24H38O5/c1-7-8-9-10-18(25)13-14-24(21(27)28-6)16-23(5)17(15-19(24)26)11-12-20(23)29-22(2,3)4/h7,17,20H,1,8-16H2,2-6H3/t17-,20-,23-,24?/m1/s1 |
| InChIKey | NEONMYUACAFEBJ-UITZZAOMSA-N |
| XLogP | 4.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|