C31H38F2N2O5Si — CID 131735728
tert-butyl 2-[3-[(1R)-1-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclobutylidene]acetate (PubChem CID 131735728) has the molecular formula C31H38F2N2O5Si and a molecular weight of 584.74 g/mol. Its IUPAC name is tert-butyl 2-[3-[(1R)-1-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclobutylidene]acetate.
| Compound Name | tert-butyl 2-[3-[(1R)-1-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclobutylidene]acetate |
|---|---|
| PubChem CID | 131735728 |
| Molecular Formula | C31H38F2N2O5Si |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | tert-butyl 2-[3-[(1R)-1-[(3,5-difluoro-4-trimethylsilylphenyl)carbamoyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclobutylidene]acetate |
| SMILES | COc1ccc2c(c1)CCN(C(=O)C1CC(=CC(=O)OC(C)(C)C)C1)[C@H]2C(=O)Nc1cc(F)c([Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C31H38F2N2O5Si/c1-31(2,3)40-26(36)14-18-12-20(13-18)30(38)35-11-10-19-15-22(39-4)8-9-23(19)27(35)29(37)34-21-16-24(32)28(25(33)17-21)41(5,6)7/h8-9,14-17,20,27H,10-13H2,1-7H3,(H,34,37)/b18-14-/t20?,27-/m1/s1 |
| InChIKey | XWQZQMHQCFUIRQ-HLBCTVKISA-N |
| XLogP | 5.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|