C25H19ClF5N3O — CID 131735964
N-[1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]ethylidene]hydroxylamine (PubChem CID 131735964) has the molecular formula C25H19ClF5N3O and a molecular weight of 507.89 g/mol. Its IUPAC name is N-[1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 131735964 |
| Molecular Formula | C25H19ClF5N3O |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-[1-[4-[3-[2-(2-chlorophenyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydropyrazol-3-yl]phenyl]phenyl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1ccc(-c2cccc(C3CC(C(F)(F)C(F)(F)F)=NN3c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C25H19ClF5N3O/c1-15(33-35)16-9-11-17(12-10-16)18-5-4-6-19(13-18)22-14-23(24(27,28)25(29,30)31)32-34(22)21-8-3-2-7-20(21)26/h2-13,22,35H,14H2,1H3 |
| InChIKey | ZBBZDOMYUDKPNM-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|