About methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate
methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 131736597) has the molecular formula C10H11F2NO5S
and a molecular weight of 295.26 g/mol. Its IUPAC name is methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate |
| PubChem CID | 131736597 |
| Molecular Formula | C10H11F2NO5S |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H11F2NO5S/c1-18-10(15)9(5-14)13-19(16,17)6-2-3-7(11)8(12)4-6/h2-4,9,13-14H,5H2,1H3/t9-/m0/s1 |
| InChIKey | RNUNHYNPYFUBQF-VIFPVBQESA-N |
| XLogP | -0.22 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate?
The IUPAC name of methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate (CID 131736597) is methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate.
What is the SMILES notation for methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate?
The canonical SMILES for methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate is COC(=O)[C@H](CO)NS(=O)(=O)c1ccc(F)c(F)c1.
What is the InChIKey of methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate?
The InChIKey is RNUNHYNPYFUBQF-VIFPVBQESA-N. The full InChI is InChI=1S/C10H11F2NO5S/c1-18-10(15)9(5-14)13-19(16,17)6-2-3-7(11)8(12)4-6/h2-4,9,13-14H,5H2,1H3/t9-/m0/s1.
What are the key properties of methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate?
methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate has a molecular weight of 295.26 g/mol, XLogP of -0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(3,4-difluorophenyl)sulfonylamino]-3-hydroxypropanoate is sourced from PubChem (CID 131736597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).