C20H26N2O4Si — CID 131736925
2-trimethylsilylethyl N-[(1S,2R,3S,5S)-2-(1,3-dioxoisoindol-2-yl)-3-bicyclo[3.1.0]hexanyl]carbamate (PubChem CID 131736925) has the molecular formula C20H26N2O4Si and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(1S,2R,3S,5S)-2-(1,3-dioxoisoindol-2-yl)-3-bicyclo[3.1.0]hexanyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(1S,2R,3S,5S)-2-(1,3-dioxoisoindol-2-yl)-3-bicyclo[3.1.0]hexanyl]carbamate |
|---|---|
| PubChem CID | 131736925 |
| Molecular Formula | C20H26N2O4Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-trimethylsilylethyl N-[(1S,2R,3S,5S)-2-(1,3-dioxoisoindol-2-yl)-3-bicyclo[3.1.0]hexanyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)N[C@H]1C[C@@H]2C[C@@H]2[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H26N2O4Si/c1-27(2,3)9-8-26-20(25)21-16-11-12-10-15(12)17(16)22-18(23)13-6-4-5-7-14(13)19(22)24/h4-7,12,15-17H,8-11H2,1-3H3,(H,21,25)/t12-,15-,16-,17+/m0/s1 |
| InChIKey | YUGGBBFEPFODEC-OSMBCOQSSA-N |
| XLogP | 3.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|