C42H44F2O4S — CID 131737016
3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;(4-tert-butylphenyl)-diphenylsulfanium (PubChem CID 131737016) has the molecular formula C42H44F2O4S and a molecular weight of 682.87 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;(4-tert-butylphenyl)-diphenylsulfanium.
| Compound Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;(4-tert-butylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 131737016 |
| Molecular Formula | C42H44F2O4S |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;(4-tert-butylphenyl)-diphenylsulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(OC(c1ccccc1)C(F)(F)C(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H23S.C20H22F2O4/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;21-20(22,17(23)24)16(15-4-2-1-3-5-15)26-18(25)19-9-12-6-13(10-19)8-14(7-12)11-19/h4-17H,1-3H3;1-5,12-14,16H,6-11H2,(H,23,24)/q+1;/p-1 |
| InChIKey | DVMKVYLEEAXXQS-UHFFFAOYSA-M |
| XLogP | 8.95 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|