C26H35FO4Si — CID 131737116
2-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl]acetic acid (PubChem CID 131737116) has the molecular formula C26H35FO4Si and a molecular weight of 458.65 g/mol. Its IUPAC name is 2-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl]acetic acid.
| Compound Name | 2-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 131737116 |
| Molecular Formula | C26H35FO4Si |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl]acetic acid |
| SMILES | CC(C)(F)[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1CC(=O)O |
| InChI | InChI=1S/C26H35FO4Si/c1-25(2,3)32(20-12-8-6-9-13-20,21-14-10-7-11-15-21)30-18-19-16-22(26(4,5)27)23(31-19)17-24(28)29/h6-15,19,22-23H,16-18H2,1-5H3,(H,28,29)/t19-,22+,23?/m0/s1 |
| InChIKey | LEGIZKYREOSLDB-BEUBQONESA-N |
| XLogP | 4.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|