C17H21N3O — CID 131737120
N-[[(2R,3S)-3-methylpiperidin-2-yl]methyl]quinoline-8-carboxamide (PubChem CID 131737120) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[[(2R,3S)-3-methylpiperidin-2-yl]methyl]quinoline-8-carboxamide.
| Compound Name | N-[[(2R,3S)-3-methylpiperidin-2-yl]methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 131737120 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[[(2R,3S)-3-methylpiperidin-2-yl]methyl]quinoline-8-carboxamide |
| SMILES | C[C@H]1CCCN[C@H]1CNC(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C17H21N3O/c1-12-5-3-9-18-15(12)11-20-17(21)14-8-2-6-13-7-4-10-19-16(13)14/h2,4,6-8,10,12,15,18H,3,5,9,11H2,1H3,(H,20,21)/t12-,15-/m0/s1 |
| InChIKey | WRMPWNBEPLUPSM-WFASDCNBSA-N |
| XLogP | 2.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |