C17H27BrN2O3SSi — CID 131737210
6-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 131737210) has the molecular formula C17H27BrN2O3SSi and a molecular weight of 447.47 g/mol. Its IUPAC name is 6-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 131737210 |
| Molecular Formula | C17H27BrN2O3SSi |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 6-bromo-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,5-dimethylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(Br)sc2c1c(=O)n(CCCO[Si](C)(C)C(C)(C)C)c(=O)n2C |
| InChI | InChI=1S/C17H27BrN2O3SSi/c1-11-12-14(21)20(16(22)19(5)15(12)24-13(11)18)9-8-10-23-25(6,7)17(2,3)4/h8-10H2,1-7H3 |
| InChIKey | ZDZCXNQDEHJHGM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|