C33H40Cl2N2O6Si — CID 131737214
6-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-3-[3-(oxan-2-yloxy)propyl]-1-(2-trimethylsilylethoxymethyl)furo[2,3-d]pyrimidine-2,4-dione (PubChem CID 131737214) has the molecular formula C33H40Cl2N2O6Si and a molecular weight of 659.68 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-3-[3-(oxan-2-yloxy)propyl]-1-(2-trimethylsilylethoxymethyl)furo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-3-[3-(oxan-2-yloxy)propyl]-1-(2-trimethylsilylethoxymethyl)furo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 131737214 |
| Molecular Formula | C33H40Cl2N2O6Si |
| Molecular Weight | 659.68 g/mol |
| Exact Mass | 658.20 |
| IUPAC Name | 6-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-3-[3-(oxan-2-yloxy)propyl]-1-(2-trimethylsilylethoxymethyl)furo[2,3-d]pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c(Cc3ccc(Cl)cc3)c(-c3cccc(Cl)c3)oc21 |
| InChI | InChI=1S/C33H40Cl2N2O6Si/c1-44(2,3)19-18-40-22-37-32-29(31(38)36(33(37)39)15-7-17-42-28-10-4-5-16-41-28)27(20-23-11-13-25(34)14-12-23)30(43-32)24-8-6-9-26(35)21-24/h6,8-9,11-14,21,28H,4-5,7,10,15-20,22H2,1-3H3 |
| InChIKey | BTUBKOKXUSDLGR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 84.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|