C25H26BF2NO2 — CID 131737228
2-(2,4-difluorophenyl)-5-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 131737228) has the molecular formula C25H26BF2NO2 and a molecular weight of 421.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-5-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2-(2,4-difluorophenyl)-5-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 131737228 |
| Molecular Formula | C25H26BF2NO2 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-(2,4-difluorophenyl)-5-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1-c1ccc(-c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C25H26BF2NO2/c1-15-11-18(26-30-24(3,4)25(5,6)31-26)12-16(2)23(15)17-7-10-22(29-14-17)20-9-8-19(27)13-21(20)28/h7-14H,1-6H3 |
| InChIKey | UVBTVVNITWNFFF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|