About bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium
bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 131737593) has the molecular formula C19H28BNO6
and a molecular weight of 377.25 g/mol. Its IUPAC name is bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 131737593 |
| Molecular Formula | C19H28BNO6 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.[O-]B(OCc1ccccc1O)OCc1ccccc1O |
| InChI | InChI=1S/C14H14BO5.C5H14NO/c16-13-7-3-1-5-11(13)9-19-15(18)20-10-12-6-2-4-8-14(12)17;1-6(2,3)4-5-7/h1-8,16-17H,9-10H2;7H,4-5H2,1-3H3/q-1;+1 |
| InChIKey | KPXBWLCFXDFZPW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium (CID 131737593) is bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.[O-]B(OCc1ccccc1O)OCc1ccccc1O.
What is the InChIKey of bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is KPXBWLCFXDFZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BO5.C5H14NO/c16-13-7-3-1-5-11(13)9-19-15(18)20-10-12-6-2-4-8-14(12)17;1-6(2,3)4-5-7/h1-8,16-17H,9-10H2;7H,4-5H2,1-3H3/q-1;+1.
What are the key properties of bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium?
bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 377.25 g/mol, XLogP of 0.86, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2-hydroxyphenyl)methoxy]borinate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 131737593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).