C28H53O13- — CID 131737892
hexadecanoate;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 131737892) has the molecular formula C28H53O13- and a molecular weight of 597.72 g/mol. Its IUPAC name is hexadecanoate;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | hexadecanoate;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 131737892 |
| Molecular Formula | C28H53O13- |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | hexadecanoate;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H32O2.C12H22O11/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h2-15H2,1H3,(H,17,18);3-20H,1-2H2/p-1/t;3-,4-,5-,6+,7-,8-,9-,10-,11-,12+/m.1/s1 |
| InChIKey | NZLRNGVTDYXZIM-PNKLPTLQSA-M |
| XLogP | -1.18 |
| TPSA | 229.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|