C26H8O12 — CID 131738135
5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 131738135) has the molecular formula C26H8O12 and a molecular weight of 512.34 g/mol. Its IUPAC name is 5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 131738135 |
| Molecular Formula | C26H8O12 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21.O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C16H6O6.C10H2O6/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-6H;1-2H |
| InChIKey | RCEQZIQECHYRAL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 181.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|