C25H33FN2O3S — CID 131739097
(3S,4S,5R)-3-[(4-amino-3-ethenyl-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 131739097) has the molecular formula C25H33FN2O3S and a molecular weight of 460.62 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(4-amino-3-ethenyl-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[(4-amino-3-ethenyl-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 131739097 |
| Molecular Formula | C25H33FN2O3S |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (3S,4S,5R)-3-[(4-amino-3-ethenyl-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | C=Cc1cc(C[C@@H]2CS(=O)(=O)C[C@H](NCc3cccc(C(C)(C)C)c3)[C@H]2O)cc(F)c1N |
| InChI | InChI=1S/C25H33FN2O3S/c1-5-18-9-17(12-21(26)23(18)27)10-19-14-32(30,31)15-22(24(19)29)28-13-16-7-6-8-20(11-16)25(2,3)4/h5-9,11-12,19,22,24,28-29H,1,10,13-15,27H2,2-4H3/t19-,22+,24+/m1/s1 |
| InChIKey | CALSDRQRZZDVLE-UCFCWBNQSA-N |
| XLogP | 3.45 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|