C26H28F3NO9S2 — CID 131739220
methyl 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 131739220) has the molecular formula C26H28F3NO9S2 and a molecular weight of 619.64 g/mol. Its IUPAC name is methyl 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 131739220 |
| Molecular Formula | C26H28F3NO9S2 |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | methyl 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1cc(C[C@@H]2CS(=O)(=O)C[C@H]3[C@H]2OC(=O)N3Cc2cccc(C(C)C)c2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C26H28F3NO9S2/c1-15(2)18-6-4-5-17(10-18)12-30-21-14-40(33,34)13-19(23(21)38-25(30)32)9-16-7-8-22(20(11-16)24(31)37-3)39-41(35,36)26(27,28)29/h4-8,10-11,15,19,21,23H,9,12-14H2,1-3H3/t19-,21+,23+/m1/s1 |
| InChIKey | OCGZCZPRMFRETN-NWSQWKLXSA-N |
| XLogP | 3.80 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|