C60H68N8O10S2 — CID 131739290
(E)-but-2-enedioic acid;bis(5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide) (PubChem CID 131739290) has the molecular formula C60H68N8O10S2 and a molecular weight of 1125.38 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide).
| Compound Name | (E)-but-2-enedioic acid;bis(5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide) |
|---|---|
| PubChem CID | 131739290 |
| Molecular Formula | C60H68N8O10S2 |
| Molecular Weight | 1125.38 g/mol |
| Exact Mass | 1124.45 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide) |
| SMILES | CCS(=O)(=O)c1cccc(-c2cc(C(=O)NC3CCN(C)CC3)c(C)c3[nH]c4ncc(C)cc4c23)c1.CCS(=O)(=O)c1cccc(-c2cc(C(=O)NC3CCN(C)CC3)c(C)c3[nH]c4ncc(C)cc4c23)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C28H32N4O3S.C4H4O4/c2*1-5-36(34,35)21-8-6-7-19(14-21)23-15-22(28(33)30-20-9-11-32(4)12-10-20)18(3)26-25(23)24-13-17(2)16-29-27(24)31-26;5-3(6)1-2-4(7)8/h2*6-8,13-16,20H,5,9-12H2,1-4H3,(H,29,31)(H,30,33);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | BSVFNRXUPFXNKA-WXXKFALUSA-N |
| XLogP | 8.95 |
| TPSA | 264.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.38 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|