C26H34Cl2N3O7PS — CID 131739291
2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-methylamino]ethyl dihydrogen phosphate;dihydrochloride (PubChem CID 131739291) has the molecular formula C26H34Cl2N3O7PS and a molecular weight of 634.52 g/mol. Its IUPAC name is 2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-methylamino]ethyl dihydrogen phosphate;dihydrochloride.
| Compound Name | 2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-methylamino]ethyl dihydrogen phosphate;dihydrochloride |
|---|---|
| PubChem CID | 131739291 |
| Molecular Formula | C26H34Cl2N3O7PS |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 2-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-methylamino]ethyl dihydrogen phosphate;dihydrochloride |
| SMILES | CCS(=O)(=O)c1cccc(-c2ccc(OCCCN(C)CCOP(=O)(O)O)c3[nH]c4ncc(C)cc4c23)c1.Cl.Cl |
| InChI | InChI=1S/C26H32N3O7PS.2ClH/c1-4-38(33,34)20-8-5-7-19(16-20)21-9-10-23(25-24(21)22-15-18(2)17-27-26(22)28-25)35-13-6-11-29(3)12-14-36-37(30,31)32;;/h5,7-10,15-17H,4,6,11-14H2,1-3H3,(H,27,28)(H2,30,31,32);2*1H |
| InChIKey | ZKRXWJGIZDWIPX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|