C37H69O8- — CID 131739815
decanoate;2,3-di(octanoyloxy)propyl octanoate (PubChem CID 131739815) has the molecular formula C37H69O8- and a molecular weight of 641.95 g/mol. Its IUPAC name is decanoate;2,3-di(octanoyloxy)propyl octanoate.
| Compound Name | decanoate;2,3-di(octanoyloxy)propyl octanoate |
|---|---|
| PubChem CID | 131739815 |
| Molecular Formula | C37H69O8- |
| Molecular Weight | 641.95 g/mol |
| Exact Mass | 641.50 |
| IUPAC Name | decanoate;2,3-di(octanoyloxy)propyl octanoate |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC.CCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C27H50O6.C10H20O2/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2;1-2-3-4-5-6-7-8-9-10(11)12/h24H,4-23H2,1-3H3;2-9H2,1H3,(H,11,12)/p-1 |
| InChIKey | ZLULFPMWLXXGKW-UHFFFAOYSA-M |
| XLogP | 8.94 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.95 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|