C39H72FN9 — CID 131739820
6-fluoro-2-N,2-N,4-N,4-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 131739820) has the molecular formula C39H72FN9 and a molecular weight of 686.07 g/mol. Its IUPAC name is 6-fluoro-2-N,2-N,4-N,4-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-fluoro-2-N,2-N,4-N,4-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 131739820 |
| Molecular Formula | C39H72FN9 |
| Molecular Weight | 686.07 g/mol |
| Exact Mass | 685.59 |
| IUPAC Name | 6-fluoro-2-N,2-N,4-N,4-N-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(N(c2nc(F)nc(N(C3CC(C)(C)NC(C)(C)C3)C3CC(C)(C)NC(C)(C)C3)n2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C39H72FN9/c1-32(2)17-25(18-33(3,4)44-32)48(26-19-34(5,6)45-35(7,8)20-26)30-41-29(40)42-31(43-30)49(27-21-36(9,10)46-37(11,12)22-27)28-23-38(13,14)47-39(15,16)24-28/h25-28,44-47H,17-24H2,1-16H3 |
| InChIKey | ZNZKPXBRFZZNTJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.07 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |