C16H17Cl2N7O3S — CID 131739905
methyl 2-[(3R,4S)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 131739905) has the molecular formula C16H17Cl2N7O3S and a molecular weight of 458.33 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(3R,4S)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 131739905 |
| Molecular Formula | C16H17Cl2N7O3S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | methyl 2-[(3R,4S)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC[C@H](NC(=O)c3[nH]c(C)c(Cl)c3Cl)[C@H](N=[N+]=[N-])C2)s1 |
| InChI | InChI=1S/C16H17Cl2N7O3S/c1-7-11(17)12(18)13(21-7)14(26)22-8-3-4-25(6-9(8)23-24-19)16-20-5-10(29-16)15(27)28-2/h5,8-9,21H,3-4,6H2,1-2H3,(H,22,26)/t8-,9+/m0/s1 |
| InChIKey | HFCDYYVHVNWROL-DTWKUNHWSA-N |
| XLogP | 3.56 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|