C42H38F3NO8-2 — CID 131740175
(2S,3S)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioate;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 131740175) has the molecular formula C42H38F3NO8-2 and a molecular weight of 741.76 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioate;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | (2S,3S)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioate;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 131740175 |
| Molecular Formula | C42H38F3NO8-2 |
| Molecular Weight | 741.76 g/mol |
| Exact Mass | 741.26 |
| IUPAC Name | (2S,3S)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioate;N-[(1R)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | C[C@@H](NCCCc1cccc(C(F)(F)F)c1)c1cccc2ccccc12.Cc1ccc(C(=O)[C@](O)(C(=O)[O-])[C@@](O)(C(=O)[O-])C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22F3N.C20H18O8/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;3-10,27-28H,1-2H3,(H,23,24)(H,25,26)/p-2/t16-;19-,20-/m10/s1 |
| InChIKey | FSYMFKGMTHBTQZ-HZUWJCSYSA-L |
| XLogP | 4.47 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|