About 2-methoxyethanol;trimethoxysilane
2-methoxyethanol;trimethoxysilane (PubChem CID 131740644) has the molecular formula C6H18O5Si
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-methoxyethanol;trimethoxysilane.
Molecular Properties
| Compound Name | 2-methoxyethanol;trimethoxysilane |
| PubChem CID | 131740644 |
| Molecular Formula | C6H18O5Si |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-methoxyethanol;trimethoxysilane |
| SMILES | COCCO.CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si.C3H8O2/c1-4-7(5-2)6-3;1-5-3-2-4/h7H,1-3H3;4H,2-3H2,1H3 |
| InChIKey | HCLIOCROCDDBHH-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethanol;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethanol;trimethoxysilane?
The IUPAC name of 2-methoxyethanol;trimethoxysilane (CID 131740644) is 2-methoxyethanol;trimethoxysilane.
What is the SMILES notation for 2-methoxyethanol;trimethoxysilane?
The canonical SMILES for 2-methoxyethanol;trimethoxysilane is COCCO.CO[SiH](OC)OC.
What is the InChIKey of 2-methoxyethanol;trimethoxysilane?
The InChIKey is HCLIOCROCDDBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C3H8O2/c1-4-7(5-2)6-3;1-5-3-2-4/h7H,1-3H3;4H,2-3H2,1H3.
What are the key properties of 2-methoxyethanol;trimethoxysilane?
2-methoxyethanol;trimethoxysilane has a molecular weight of 198.29 g/mol, XLogP of -0.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethanol;trimethoxysilane is sourced from PubChem (CID 131740644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).