About methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate
methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate (PubChem CID 131740730) has the molecular formula C17H24N2O5
and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate |
| PubChem CID | 131740730 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OC)nc1CC[C@H]1CC[C@H](C(=O)OC)CN1 |
| InChI | InChI=1S/C17H24N2O5/c1-22-15-9-7-13(17(21)24-3)14(19-15)8-6-12-5-4-11(10-18-12)16(20)23-2/h7,9,11-12,18H,4-6,8,10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | WPNVTNABJVRKEV-NWDGAFQWSA-N |
| XLogP | 1.35 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate?
The IUPAC name of methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate (CID 131740730) is methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate is COC(=O)c1ccc(OC)nc1CC[C@H]1CC[C@H](C(=O)OC)CN1.
What is the InChIKey of methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate?
The InChIKey is WPNVTNABJVRKEV-NWDGAFQWSA-N. The full InChI is InChI=1S/C17H24N2O5/c1-22-15-9-7-13(17(21)24-3)14(19-15)8-6-12-5-4-11(10-18-12)16(20)23-2/h7,9,11-12,18H,4-6,8,10H2,1-3H3/t11-,12+/m0/s1.
What are the key properties of methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate?
methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate has a molecular weight of 336.39 g/mol, XLogP of 1.35, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methoxy-2-[2-[(2R,5S)-5-methoxycarbonylpiperidin-2-yl]ethyl]pyridine-3-carboxylate is sourced from PubChem (CID 131740730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).