About 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate
2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (PubChem CID 131740794) has the molecular formula C20H26O10
and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| PubChem CID | 131740794 |
| Molecular Formula | C20H26O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CC(C)=O.CCOc1cc(C(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C10H12O5.C10H14O5/c1-2-15-8-5-6(3-4-7(8)11)9(12)10(13)14;1-7(2)10(13)15-5-4-14-9(12)6-8(3)11/h3-5,9,11-12H,2H2,1H3,(H,13,14);1,4-6H2,2-3H3 |
| InChIKey | MADPNDFHZZQUTJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The IUPAC name of 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate (CID 131740794) is 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate.
What is the SMILES notation for 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The canonical SMILES for 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate is C=C(C)C(=O)OCCOC(=O)CC(C)=O.CCOc1cc(C(O)C(=O)O)ccc1O.
What is the InChIKey of 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
The InChIKey is MADPNDFHZZQUTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5.C10H14O5/c1-2-15-8-5-6(3-4-7(8)11)9(12)10(13)14;1-7(2)10(13)15-5-4-14-9(12)6-8(3)11/h3-5,9,11-12H,2H2,1H3,(H,13,14);1,4-6H2,2-3H3.
What are the key properties of 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate?
2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate has a molecular weight of 426.42 g/mol, XLogP of 1.54, 10 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethoxy-4-hydroxyphenyl)-2-hydroxyacetic acid;2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate is sourced from PubChem (CID 131740794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).