C9H11F9N2O3S — CID 131740800
N-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]propanamide (PubChem CID 131740800) has the molecular formula C9H11F9N2O3S and a molecular weight of 398.25 g/mol. Its IUPAC name is N-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]propanamide.
| Compound Name | N-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 131740800 |
| Molecular Formula | C9H11F9N2O3S |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | N-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]propanamide |
| SMILES | CCC(=O)NCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9N2O3S/c1-2-5(21)19-3-4-20-24(22,23)9(17,18)7(12,13)6(10,11)8(14,15)16/h20H,2-4H2,1H3,(H,19,21) |
| InChIKey | INQBTWZISDGAPK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|